|
|
DSpace at IIT Bombay >
Browsing by Author BALAKRISHNA, MS
Showing results 76 to 95 of 100
| Issue Date | Title | Author(s) | | 2007 | Synthesis and structural studies of RhI, PdI, NiII complexes and one-pot synthesis of binuclear RuII complex [(η6-p-cymene)Ru(μ2-Cl)3Ru{PhN(P(OC6H4OMe-o)2)2}Cl] | CHELLADURAI, GANESAMOORTHY; MAGUE, JOEL T; BALAKRISHNA, MS |
| 2005 | Synthesis and thermochemical study of ligand substitution reactions of aminobis(phosphines), Ph2P(R)NPPh2, with [Me2Pt(COD)] | BALAKRISHNA, MS; PRIYA, SRINIVASAN; SOMMER, WILLIAM; NOLAN, STEVEN P |
| 2011 | Synthesis and transition metal chemistry of a bridging diphosphinite, 1,4 bis(diphenylphosphinoxy)benzene | BALAKRISHNA, MS; SURESH, D; KUMAR, P; MAGUE, JT |
| 2011 | Synthesis and transition metal chemistry of a bridging diphosphinite, 1,4 bis(diphenylphosphinoxy)benzene | BALAKRISHNA, MS; SURESH, D; KUMAR, P; MAGUE, JT |
| 2001 | Synthesis and X-ray crystal structure of a novel long chain acyclic phosphazene, N,N′-{dimethyl-bis(diphenylphosphiniminophosphorane)}ethylenediamine {(PhO)2P(O)N=PN(CH3)CH2}2, obtained via a Staudinger reaction | BALAKRISHNA, MS; ABHYANKAR, RITA M; WALAWALKAR, MRINALINI G |
| 2006 | Synthesis of neutral (pd-ii,pt-ii), cationic (pdii), and water-induced anionic (pd-ii) complexes containing new mesocyclic - thioether-aminophosphonite ligands and their application in the suzuki cross-coupling reaction | PUNJI, B; MAGUE, JT; BALAKRISHNA, MS |
| 2004 | Synthesis of phenylamino bis(dichlorophosphine oxide) and its complexes with group 12 metals | PRIYA, S; BALAKRISHNA, MS |
| 2002 | Synthesis, spectroscopic study and X-ray crystal structure of unsymmetrical bis(phosphine)-platinum complex, [PtCl2{eta(2)-Ph2POCH2CH2N(CH3)PPh2] | BALAKRISHNA, MS; MCDONALD, R |
| 2002 | Synthesis, spectroscopic study and x-ray crystal structure of unsymmetrical bis(phosphine)-platinum complex, [ptcl2{n(2)-ph2poch2ch2n(ch3)pph2}] (vol 5, pg 782, 2002) | BALAKRISHNA, MS; MCDONALD, R |
| 2002 | Synthesis, spectroscopic study and X-ray crystal structure of unsymmetrical bis(phosphine)-platinum complex, [PtCl2{η2-Ph2POCH2CH2N(CH3)PPh2] | BALAKRISHNA, MS; MCDONALD, ROBERT |
| 2003 | Synthesis, structures, spectroscopic and electrochemical studies of Ru(II) complexes containing bis(phosphino)amine ligands. Crystal and molecular structures of trans-[RuCl2{Ph2PN(Me)PPh2-κP,κP}2] and trans-[RuCl2{Ph2PN(iPr)PPh2-κP,κP}2] | BALAKRISHNA, MS; PANDA, RASHMISHREE; MAGUE, JOEL T |
| 2007 | Tetrakis(1-naphthylamino) silane and its tetrahydrofuran trisolvate | BALAKRISHNA, MS; CHIVERS, T; PARVEZ, M |
| 2006 | The tetralithium derivative of the tetrakis(1-naphthylimido)silicate tetraanion | COPSEY, MC; BALAKRISHNA, MS; CHIVERS, T |
| 2005 | Tetranuclear rhodium(I) macrocycle containing cyclodiphosphazane [Rh-2(mu-Cl)(2)(CO)(2){((BuNP)-Bu-t(OC6H4OMe-o))(2)-kappa P](2) and its reversible conversion into trans-[Rh(CO)Cl{((BuNP)-Bu-t(OC6H4OMe-o))(2-)kappa P}(2)] | CHANDRASEKARAN, P; MAGUE, JT; BALAKRISHNA, MS |
| 2007 | Thioether-functionalized ferrocenyl-bis(phosphonite), Fe{(C5H4)P(-OC10H6(mu-S)C10H6O-)}(2): Synthesis, coordination behavior, and application in suzuki-miyaura cross-coupling reactions | PUNJI, B; MAGUE, JT; BALAKRISHNA, MS |
| 2001 | Three new spirocyclic palladium(0) complexes containing diphosphines derived from N,N '-substituted ethylenediamines | BALAKRISHNA, MS |
| 2001 | Transition metal chemistry of phosphorus based ligands: Bis(diaryloxyphosphino)amine ligands and their palladium(II) and platinum(II) derivatives | BALAKRISHNA, MS |
| 1998 | Transition metal chemistry of phosphorus based ligands. Ruthenium(II) chemistry of bis(phosphino)amines, X2PN(R)PX2 (R = H or Ph, X = Ph; R = Ph, X-2 = O2C6H4) | BALAKRISHNA, MS; RAMASWAMY, K; ABHYANKAR, RM |
| 2001 | Transition metal chemistry of phosphorus based ligands: synthesis and transition metal chemistry of N,N′-dimethyl,-bis(diphenylphosphino)ethylenediamine. The crystal and molecular structure of [ReBr(CO)3{Ph2PN(Me)CH2CH2(Me)NPPh2}] | BALAKRISHNA, MS; WALAWALKAR, MRINALINI G |
| 2003 | Transition metal (Group 6, Ru and Group 10) derivatives of aminophosphines, Ph2PN(H)R (R=Ph, C6H11) | SRINIVASAN, PRASHANT; BALAKRISHNA, MS; MAGUE, JOEL T |
Showing results 76 to 95 of 100
|
