|
DSpace at IIT Bombay >
Browsing by Author ABHYANKAR, RM
Showing results 1 to 2 of 2
| Issue Date | Title | Author(s) | | 1999 | New bis(phosphines) derived from N,N '-substituted ethylenediamine derivatives. Synthesis and transition metal chemistry of X2PN(R)CH2CH2(R)NPX2 (R = CH2Ph or Ph, X = Ph; R = CH2Ph, X-2 = O2C6H4). The crystal and molecular structure of Ph2PN(CH2Ph)CH2CH2(CH2Ph)NPPh2 and cis-[{PtCl2Ph2PN(CH2Ph)CH2CH2(CH2Ph)NPPh2}] | BALAKRISHNA, MS; ABHYANKAR, RM; MAGUE, JT |
| 1998 | Transition metal chemistry of phosphorus based ligands. Ruthenium(II) chemistry of bis(phosphino)amines, X2PN(R)PX2 (R = H or Ph, X = Ph; R = Ph, X-2 = O2C6H4) | BALAKRISHNA, MS; RAMASWAMY, K; ABHYANKAR, RM |
Showing results 1 to 2 of 2
|
